C11H20OS — CID 101224001
2-(2,4-dimethylpent-3-enyl)-2-methyl-1,3-oxathiolane (PubChem CID 101224001) has the molecular formula C11H20OS and a molecular weight of 200.35 g/mol. Its IUPAC name is 2-(2,4-dimethylpent-3-enyl)-2-methyl-1,3-oxathiolane.
| Compound Name | 2-(2,4-dimethylpent-3-enyl)-2-methyl-1,3-oxathiolane |
|---|---|
| PubChem CID | 101224001 |
| Molecular Formula | C11H20OS |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 2-(2,4-dimethylpent-3-enyl)-2-methyl-1,3-oxathiolane |
| SMILES | CC(C)=CC(C)CC1(C)OCCS1 |
| InChI | InChI=1S/C11H20OS/c1-9(2)7-10(3)8-11(4)12-5-6-13-11/h7,10H,5-6,8H2,1-4H3 |
| InChIKey | BYTXZVPRLCSDFK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|