C9H16OS — CID 153213014
(2S,4R)-2-methoxy-4-[(Z)-prop-1-enyl]thiane (PubChem CID 153213014) has the molecular formula C9H16OS and a molecular weight of 172.29 g/mol. Its IUPAC name is (2S,4R)-2-methoxy-4-[(Z)-prop-1-enyl]thiane.
| Compound Name | (2S,4R)-2-methoxy-4-[(Z)-prop-1-enyl]thiane |
|---|---|
| PubChem CID | 153213014 |
| Molecular Formula | C9H16OS |
| Molecular Weight | 172.29 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | (2S,4R)-2-methoxy-4-[(Z)-prop-1-enyl]thiane |
| SMILES | C/C=C\[C@@H]1CCS[C@H](OC)C1 |
| InChI | InChI=1S/C9H16OS/c1-3-4-8-5-6-11-9(7-8)10-2/h3-4,8-9H,5-7H2,1-2H3/b4-3-/t8-,9+/m1/s1 |
| InChIKey | WMEAESQDELXRKI-NESOUNQCSA-N |
| XLogP | 2.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.29 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|