C14H22OS — CID 143517627
4-[(2Z,4E,6Z)-5-methylsulfanylocta-2,4,6-trien-3-yl]oxane (PubChem CID 143517627) has the molecular formula C14H22OS and a molecular weight of 238.40 g/mol. Its IUPAC name is 4-[(2Z,4E,6Z)-5-methylsulfanylocta-2,4,6-trien-3-yl]oxane.
| Compound Name | 4-[(2Z,4E,6Z)-5-methylsulfanylocta-2,4,6-trien-3-yl]oxane |
|---|---|
| PubChem CID | 143517627 |
| Molecular Formula | C14H22OS |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 4-[(2Z,4E,6Z)-5-methylsulfanylocta-2,4,6-trien-3-yl]oxane |
| SMILES | C/C=C\C(=C/C(=C\C)C1CCOCC1)SC |
| InChI | InChI=1S/C14H22OS/c1-4-6-14(16-3)11-12(5-2)13-7-9-15-10-8-13/h4-6,11,13H,7-10H2,1-3H3/b6-4-,12-5+,14-11+ |
| InChIKey | MABQGPKAOQQMFT-IVAIWEIBSA-N |
| XLogP | 4.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|