C13H16O — CID 163498361
4-(5-methylcyclohepta-1,2,4,6-tetraen-1-yl)oxane (PubChem CID 163498361) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is 4-(5-methylcyclohepta-1,2,4,6-tetraen-1-yl)oxane.
| Compound Name | 4-(5-methylcyclohepta-1,2,4,6-tetraen-1-yl)oxane |
|---|---|
| PubChem CID | 163498361 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 4-(5-methylcyclohepta-1,2,4,6-tetraen-1-yl)oxane |
| SMILES | CC1=CC=C=C(C2CCOCC2)C=C1 |
| InChI | InChI=1S/C13H16O/c1-11-3-2-4-12(6-5-11)13-7-9-14-10-8-13/h2-3,5-6,13H,7-10H2,1H3 |
| InChIKey | CSPNTJPYJTVGJR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |