C11H16O — CID 143062740
4-[(3E)-hexa-1,3,5-trien-3-yl]oxane (PubChem CID 143062740) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is 4-[(3E)-hexa-1,3,5-trien-3-yl]oxane.
| Compound Name | 4-[(3E)-hexa-1,3,5-trien-3-yl]oxane |
|---|---|
| PubChem CID | 143062740 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | 4-[(3E)-hexa-1,3,5-trien-3-yl]oxane |
| SMILES | C=C/C=C(\C=C)C1CCOCC1 |
| InChI | InChI=1S/C11H16O/c1-3-5-10(4-2)11-6-8-12-9-7-11/h3-5,11H,1-2,6-9H2/b10-5+ |
| InChIKey | WTEKLTXVLLLXOI-BJMVGYQFSA-N |
| XLogP | 2.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|