C13H14O — CID 54399020
3,4,4a,10a-tetrahydro-1H-benzo[g]isochromene (PubChem CID 54399020) has the molecular formula C13H14O and a molecular weight of 186.25 g/mol. Its IUPAC name is 3,4,4a,10a-tetrahydro-1H-benzo[g]isochromene.
| Compound Name | 3,4,4a,10a-tetrahydro-1H-benzo[g]isochromene |
|---|---|
| PubChem CID | 54399020 |
| Molecular Formula | C13H14O |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 3,4,4a,10a-tetrahydro-1H-benzo[g]isochromene |
| SMILES | C1=c2ccccc2=CC2COCCC12 |
| InChI | InChI=1S/C13H14O/c1-2-4-11-8-13-9-14-6-5-12(13)7-10(11)3-1/h1-4,7-8,12-13H,5-6,9H2 |
| InChIKey | VMBSTXKBBZYKON-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |