C9H11O+ — CID 146169253
3,4,8,8a-tetrahydro-1H-isochromen-8-ylium (PubChem CID 146169253) has the molecular formula C9H11O+ and a molecular weight of 135.19 g/mol. Its IUPAC name is 3,4,8,8a-tetrahydro-1H-isochromen-8-ylium.
| Compound Name | 3,4,8,8a-tetrahydro-1H-isochromen-8-ylium |
|---|---|
| PubChem CID | 146169253 |
| Molecular Formula | C9H11O+ |
| Molecular Weight | 135.19 g/mol |
| Exact Mass | 135.08 |
| IUPAC Name | 3,4,8,8a-tetrahydro-1H-isochromen-8-ylium |
| SMILES | C1=C[CH+]C2COCCC2=C1 |
| InChI | InChI=1S/C9H11O/c1-2-4-9-7-10-6-5-8(9)3-1/h1-4,9H,5-7H2/q+1 |
| InChIKey | MBJRBZNANLVXOI-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.19 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|