C11H15O+ — CID 137302550
(1R)-1,3-dimethyl-3,4,6,8a-tetrahydro-1H-isochromen-6-ylium (PubChem CID 137302550) has the molecular formula C11H15O+ and a molecular weight of 163.24 g/mol. Its IUPAC name is (1R)-1,3-dimethyl-3,4,6,8a-tetrahydro-1H-isochromen-6-ylium.
| Compound Name | (1R)-1,3-dimethyl-3,4,6,8a-tetrahydro-1H-isochromen-6-ylium |
|---|---|
| PubChem CID | 137302550 |
| Molecular Formula | C11H15O+ |
| Molecular Weight | 163.24 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | (1R)-1,3-dimethyl-3,4,6,8a-tetrahydro-1H-isochromen-6-ylium |
| SMILES | CC1CC2=C[CH+]C=CC2[C@@H](C)O1 |
| InChI | InChI=1S/C11H15O/c1-8-7-10-5-3-4-6-11(10)9(2)12-8/h3-6,8-9,11H,7H2,1-2H3/q+1/t8?,9-,11?/m1/s1 |
| InChIKey | UINQTIOEFITESV-INWMGODYSA-N |
| XLogP | 2.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.24 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|