C16H28OS — CID 143517626
ethane;4-[(2Z,4E,6Z)-5-methylsulfanylocta-2,4,6-trien-3-yl]oxane (PubChem CID 143517626) has the molecular formula C16H28OS and a molecular weight of 268.47 g/mol. Its IUPAC name is ethane;4-[(2Z,4E,6Z)-5-methylsulfanylocta-2,4,6-trien-3-yl]oxane.
| Compound Name | ethane;4-[(2Z,4E,6Z)-5-methylsulfanylocta-2,4,6-trien-3-yl]oxane |
|---|---|
| PubChem CID | 143517626 |
| Molecular Formula | C16H28OS |
| Molecular Weight | 268.47 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | ethane;4-[(2Z,4E,6Z)-5-methylsulfanylocta-2,4,6-trien-3-yl]oxane |
| SMILES | C/C=C\C(=C/C(=C\C)C1CCOCC1)SC.CC |
| InChI | InChI=1S/C14H22OS.C2H6/c1-4-6-14(16-3)11-12(5-2)13-7-9-15-10-8-13;1-2/h4-6,11,13H,7-10H2,1-3H3;1-2H3/b6-4-,12-5+,14-11+; |
| InChIKey | PVVZMEJCCGXUBB-YRFRQTDFSA-N |
| XLogP | 5.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.47 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|