C23H22ClNO4 — CID 15953479
10-methyl-9-(2,4,6-trimethylphenyl)acridin-10-ium perchlorate (PubChem CID 15953479) has the molecular formula C23H22ClNO4 and a molecular weight of 411.89 g/mol. Its IUPAC name is 10-methyl-9-(2,4,6-trimethylphenyl)acridin-10-ium perchlorate.
| Compound Name | 10-methyl-9-(2,4,6-trimethylphenyl)acridin-10-ium perchlorate |
|---|---|
| PubChem CID | 15953479 |
| Molecular Formula | C23H22ClNO4 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 10-methyl-9-(2,4,6-trimethylphenyl)acridin-10-ium perchlorate |
| SMILES | Cc1cc(C)c(-c2c3ccccc3[n+](C)c3ccccc23)c(C)c1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C23H22N.ClHO4/c1-15-13-16(2)22(17(3)14-15)23-18-9-5-7-11-20(18)24(4)21-12-8-6-10-19(21)23;2-1(3,4)5/h5-14H,1-4H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | LFMBERYWDLWXNO-UHFFFAOYSA-M |
| XLogP | 0.65 |
| TPSA | 96.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|