C22H17N3OP+ — CID 159538962
benzyl-oxo-(7-pyridin-4-yl-3,5-dihydropyrrolo[3,4-f]indol-2-yl)phosphanium (PubChem CID 159538962) has the molecular formula C22H17N3OP+ and a molecular weight of 370.37 g/mol. Its IUPAC name is benzyl-oxo-(7-pyridin-4-yl-3,5-dihydropyrrolo[3,4-f]indol-2-yl)phosphanium.
| Compound Name | benzyl-oxo-(7-pyridin-4-yl-3,5-dihydropyrrolo[3,4-f]indol-2-yl)phosphanium |
|---|---|
| PubChem CID | 159538962 |
| Molecular Formula | C22H17N3OP+ |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | benzyl-oxo-(7-pyridin-4-yl-3,5-dihydropyrrolo[3,4-f]indol-2-yl)phosphanium |
| SMILES | O=[P+](Cc1ccccc1)C1=Nc2cc3c(cc2C1)CN=C3c1ccncc1 |
| InChI | InChI=1S/C22H17N3OP/c26-27(14-15-4-2-1-3-5-15)21-11-17-10-18-13-24-22(16-6-8-23-9-7-16)19(18)12-20(17)25-21/h1-10,12H,11,13-14H2/q+1 |
| InChIKey | HXYITNVDWYMNJX-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 54.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|