C24H19N3O — CID 172957272
(NZ)-N-[2-phenyl-1-(1-pyridin-4-yl-3,5-dihydrocyclopenta[f]isoindol-6-yl)ethylidene]hydroxylamine (PubChem CID 172957272) has the molecular formula C24H19N3O and a molecular weight of 365.44 g/mol. Its IUPAC name is (NZ)-N-[2-phenyl-1-(1-pyridin-4-yl-3,5-dihydrocyclopenta[f]isoindol-6-yl)ethylidene]hydroxylamine.
| Compound Name | (NZ)-N-[2-phenyl-1-(1-pyridin-4-yl-3,5-dihydrocyclopenta[f]isoindol-6-yl)ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 172957272 |
| Molecular Formula | C24H19N3O |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | (NZ)-N-[2-phenyl-1-(1-pyridin-4-yl-3,5-dihydrocyclopenta[f]isoindol-6-yl)ethylidene]hydroxylamine |
| SMILES | O/N=C(/Cc1ccccc1)C1=Cc2cc3c(cc2C1)CN=C3c1ccncc1 |
| InChI | InChI=1S/C24H19N3O/c28-27-23(10-16-4-2-1-3-5-16)20-11-18-13-21-15-26-24(17-6-8-25-9-7-17)22(21)14-19(18)12-20/h1-9,12-14,28H,10-11,15H2/b27-23- |
| InChIKey | WXJAQKRBGJLRNR-VYIQYICTSA-N |
| XLogP | 4.45 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|