C33H42FN5O2 — CID 159540059
3-cyclopropyl-5-methyl-1H-pyrazole;(E)-4-(3-fluoropiperidin-1-yl)-N-[5-[3-(2-methyl-4-oxopentan-3-yl)phenyl]-2-pyridinyl]but-2-enamide (PubChem CID 159540059) has the molecular formula C33H42FN5O2 and a molecular weight of 559.73 g/mol. Its IUPAC name is 3-cyclopropyl-5-methyl-1H-pyrazole;(E)-4-(3-fluoropiperidin-1-yl)-N-[5-[3-(2-methyl-4-oxopentan-3-yl)phenyl]-2-pyridinyl]but-2-enamide.
| Compound Name | 3-cyclopropyl-5-methyl-1H-pyrazole;(E)-4-(3-fluoropiperidin-1-yl)-N-[5-[3-(2-methyl-4-oxopentan-3-yl)phenyl]-2-pyridinyl]but-2-enamide |
|---|---|
| PubChem CID | 159540059 |
| Molecular Formula | C33H42FN5O2 |
| Molecular Weight | 559.73 g/mol |
| Exact Mass | 559.33 |
| IUPAC Name | 3-cyclopropyl-5-methyl-1H-pyrazole;(E)-4-(3-fluoropiperidin-1-yl)-N-[5-[3-(2-methyl-4-oxopentan-3-yl)phenyl]-2-pyridinyl]but-2-enamide |
| SMILES | CC(=O)C(c1cccc(-c2ccc(NC(=O)/C=C/CN3CCCC(F)C3)nc2)c1)C(C)C.Cc1cc(C2CC2)n[nH]1 |
| InChI | InChI=1S/C26H32FN3O2.C7H10N2/c1-18(2)26(19(3)31)21-8-4-7-20(15-21)22-11-12-24(28-16-22)29-25(32)10-6-14-30-13-5-9-23(27)17-30;1-5-4-7(9-8-5)6-2-3-6/h4,6-8,10-12,15-16,18,23,26H,5,9,13-14,17H2,1-3H3,(H,28,29,32);4,6H,2-3H2,1H3,(H,8,9)/b10-6+; |
| InChIKey | MEBWAUHPDZXHEV-AAGWESIMSA-N |
| XLogP | 6.60 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.73 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|