C23H29F2N3O4Si — CID 159545861
N-[3-(3,5-difluoro-4-trimethylsilylphenyl)-1-(oxan-4-yl)-2-oxopropyl]-2-(6-oxopyrimidin-1-yl)acetamide (PubChem CID 159545861) has the molecular formula C23H29F2N3O4Si and a molecular weight of 477.58 g/mol. Its IUPAC name is N-[3-(3,5-difluoro-4-trimethylsilylphenyl)-1-(oxan-4-yl)-2-oxopropyl]-2-(6-oxopyrimidin-1-yl)acetamide.
| Compound Name | N-[3-(3,5-difluoro-4-trimethylsilylphenyl)-1-(oxan-4-yl)-2-oxopropyl]-2-(6-oxopyrimidin-1-yl)acetamide |
|---|---|
| PubChem CID | 159545861 |
| Molecular Formula | C23H29F2N3O4Si |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | N-[3-(3,5-difluoro-4-trimethylsilylphenyl)-1-(oxan-4-yl)-2-oxopropyl]-2-(6-oxopyrimidin-1-yl)acetamide |
| SMILES | C[Si](C)(C)c1c(F)cc(CC(=O)C(NC(=O)Cn2cnccc2=O)C2CCOCC2)cc1F |
| InChI | InChI=1S/C23H29F2N3O4Si/c1-33(2,3)23-17(24)10-15(11-18(23)25)12-19(29)22(16-5-8-32-9-6-16)27-20(30)13-28-14-26-7-4-21(28)31/h4,7,10-11,14,16,22H,5-6,8-9,12-13H2,1-3H3,(H,27,30) |
| InChIKey | MEUFCSWCOLMAMA-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|