C21H26F2N2O5Si — CID 159160294
N-[3-(3,5-difluoro-4-trimethylsilylphenyl)-1-(oxan-4-yl)-2-oxopropyl]-3-oxo-1,2-oxazole-5-carboxamide (PubChem CID 159160294) has the molecular formula C21H26F2N2O5Si and a molecular weight of 452.53 g/mol. Its IUPAC name is N-[3-(3,5-difluoro-4-trimethylsilylphenyl)-1-(oxan-4-yl)-2-oxopropyl]-3-oxo-1,2-oxazole-5-carboxamide.
| Compound Name | N-[3-(3,5-difluoro-4-trimethylsilylphenyl)-1-(oxan-4-yl)-2-oxopropyl]-3-oxo-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 159160294 |
| Molecular Formula | C21H26F2N2O5Si |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | N-[3-(3,5-difluoro-4-trimethylsilylphenyl)-1-(oxan-4-yl)-2-oxopropyl]-3-oxo-1,2-oxazole-5-carboxamide |
| SMILES | C[Si](C)(C)c1c(F)cc(CC(=O)C(NC(=O)c2cc(=O)[nH]o2)C2CCOCC2)cc1F |
| InChI | InChI=1S/C21H26F2N2O5Si/c1-31(2,3)20-14(22)8-12(9-15(20)23)10-16(26)19(13-4-6-29-7-5-13)24-21(28)17-11-18(27)25-30-17/h8-9,11,13,19H,4-7,10H2,1-3H3,(H,24,28)(H,25,27) |
| InChIKey | KKKBUWCTIRXQEA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 101.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|