C15H19F3N2O2 — CID 97338158
1-methyl-3-[(1R)-1-[(3S)-oxolan-3-yl]ethyl]-1-[(3,4,5-trifluorophenyl)methyl]urea (PubChem CID 97338158) has the molecular formula C15H19F3N2O2 and a molecular weight of 316.32 g/mol. Its IUPAC name is 1-methyl-3-[(1R)-1-[(3S)-oxolan-3-yl]ethyl]-1-[(3,4,5-trifluorophenyl)methyl]urea.
| Compound Name | 1-methyl-3-[(1R)-1-[(3S)-oxolan-3-yl]ethyl]-1-[(3,4,5-trifluorophenyl)methyl]urea |
|---|---|
| PubChem CID | 97338158 |
| Molecular Formula | C15H19F3N2O2 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 1-methyl-3-[(1R)-1-[(3S)-oxolan-3-yl]ethyl]-1-[(3,4,5-trifluorophenyl)methyl]urea |
| SMILES | C[C@@H](NC(=O)N(C)Cc1cc(F)c(F)c(F)c1)[C@@H]1CCOC1 |
| InChI | InChI=1S/C15H19F3N2O2/c1-9(11-3-4-22-8-11)19-15(21)20(2)7-10-5-12(16)14(18)13(17)6-10/h5-6,9,11H,3-4,7-8H2,1-2H3,(H,19,21)/t9-,11-/m1/s1 |
| InChIKey | PGDUYXKRWROIEW-MWLCHTKSSA-N |
| XLogP | 2.67 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|