About 2-chloro-4,5-difluoro-N-[3-hydroxy-1-(oxan-4-yl)propyl]benzamide
2-chloro-4,5-difluoro-N-[3-hydroxy-1-(oxan-4-yl)propyl]benzamide (PubChem CID 136531595) has the molecular formula C15H18ClF2NO3
and a molecular weight of 333.76 g/mol. Its IUPAC name is 2-chloro-4,5-difluoro-N-[3-hydroxy-1-(oxan-4-yl)propyl]benzamide.
Molecular Properties
| Compound Name | 2-chloro-4,5-difluoro-N-[3-hydroxy-1-(oxan-4-yl)propyl]benzamide |
| PubChem CID | 136531595 |
| Molecular Formula | C15H18ClF2NO3 |
| Molecular Weight | 333.76 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 2-chloro-4,5-difluoro-N-[3-hydroxy-1-(oxan-4-yl)propyl]benzamide |
| SMILES | O=C(NC(CCO)C1CCOCC1)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C15H18ClF2NO3/c16-11-8-13(18)12(17)7-10(11)15(21)19-14(1-4-20)9-2-5-22-6-3-9/h7-9,14,20H,1-6H2,(H,19,21) |
| InChIKey | ZCTZVUUTMMXKKM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.76 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4,5-difluoro-N-[3-hydroxy-1-(oxan-4-yl)propyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4,5-difluoro-N-[3-hydroxy-1-(oxan-4-yl)propyl]benzamide?
The IUPAC name of 2-chloro-4,5-difluoro-N-[3-hydroxy-1-(oxan-4-yl)propyl]benzamide (CID 136531595) is 2-chloro-4,5-difluoro-N-[3-hydroxy-1-(oxan-4-yl)propyl]benzamide.
What is the SMILES notation for 2-chloro-4,5-difluoro-N-[3-hydroxy-1-(oxan-4-yl)propyl]benzamide?
The canonical SMILES for 2-chloro-4,5-difluoro-N-[3-hydroxy-1-(oxan-4-yl)propyl]benzamide is O=C(NC(CCO)C1CCOCC1)c1cc(F)c(F)cc1Cl.
What is the InChIKey of 2-chloro-4,5-difluoro-N-[3-hydroxy-1-(oxan-4-yl)propyl]benzamide?
The InChIKey is ZCTZVUUTMMXKKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18ClF2NO3/c16-11-8-13(18)12(17)7-10(11)15(21)19-14(1-4-20)9-2-5-22-6-3-9/h7-9,14,20H,1-6H2,(H,19,21).
What are the key properties of 2-chloro-4,5-difluoro-N-[3-hydroxy-1-(oxan-4-yl)propyl]benzamide?
2-chloro-4,5-difluoro-N-[3-hydroxy-1-(oxan-4-yl)propyl]benzamide has a molecular weight of 333.76 g/mol, XLogP of 2.53, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4,5-difluoro-N-[3-hydroxy-1-(oxan-4-yl)propyl]benzamide is sourced from PubChem (CID 136531595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).