C15H18ClF2NO3 — CID 136531595
2-chloro-4,5-difluoro-N-[3-hydroxy-1-(oxan-4-yl)propyl]benzamide (PubChem CID 136531595) has the molecular formula C15H18ClF2NO3 and a molecular weight of 333.76 g/mol. Its IUPAC name is 2-chloro-4,5-difluoro-N-[3-hydroxy-1-(oxan-4-yl)propyl]benzamide.
| Compound Name | 2-chloro-4,5-difluoro-N-[3-hydroxy-1-(oxan-4-yl)propyl]benzamide |
|---|---|
| PubChem CID | 136531595 |
| Molecular Formula | C15H18ClF2NO3 |
| Molecular Weight | 333.76 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 2-chloro-4,5-difluoro-N-[3-hydroxy-1-(oxan-4-yl)propyl]benzamide |
| SMILES | O=C(NC(CCO)C1CCOCC1)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C15H18ClF2NO3/c16-11-8-13(18)12(17)7-10(11)15(21)19-14(1-4-20)9-2-5-22-6-3-9/h7-9,14,20H,1-6H2,(H,19,21) |
| InChIKey | ZCTZVUUTMMXKKM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.76 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|