C14H21F2N3O3 — CID 136564873
5-(difluoromethyl)-N-[3-hydroxy-1-(oxan-4-yl)propyl]-1-methylpyrazole-3-carboxamide (PubChem CID 136564873) has the molecular formula C14H21F2N3O3 and a molecular weight of 317.34 g/mol. Its IUPAC name is 5-(difluoromethyl)-N-[3-hydroxy-1-(oxan-4-yl)propyl]-1-methylpyrazole-3-carboxamide.
| Compound Name | 5-(difluoromethyl)-N-[3-hydroxy-1-(oxan-4-yl)propyl]-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 136564873 |
| Molecular Formula | C14H21F2N3O3 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 5-(difluoromethyl)-N-[3-hydroxy-1-(oxan-4-yl)propyl]-1-methylpyrazole-3-carboxamide |
| SMILES | Cn1nc(C(=O)NC(CCO)C2CCOCC2)cc1C(F)F |
| InChI | InChI=1S/C14H21F2N3O3/c1-19-12(13(15)16)8-11(18-19)14(21)17-10(2-5-20)9-3-6-22-7-4-9/h8-10,13,20H,2-7H2,1H3,(H,17,21) |
| InChIKey | UOZGSEWEGAJPHC-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |