C15H19N5O4 — CID 15954973
7-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-4-(dimethylamino)pyrrolo[2,3-d]pyrimidine-5-carbonitrile (PubChem CID 15954973) has the molecular formula C15H19N5O4 and a molecular weight of 333.35 g/mol. Its IUPAC name is 7-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-4-(dimethylamino)pyrrolo[2,3-d]pyrimidine-5-carbonitrile.
| Compound Name | 7-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-4-(dimethylamino)pyrrolo[2,3-d]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 15954973 |
| Molecular Formula | C15H19N5O4 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 7-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-4-(dimethylamino)pyrrolo[2,3-d]pyrimidine-5-carbonitrile |
| SMILES | CN(C)c1ncnc2c1c(C#N)cn2[C@@H]1O[C@H](CO)[C@@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C15H19N5O4/c1-15(23)11(22)9(6-21)24-14(15)20-5-8(4-16)10-12(19(2)3)17-7-18-13(10)20/h5,7,9,11,14,21-23H,6H2,1-3H3/t9-,11-,14-,15-/m1/s1 |
| InChIKey | FTDSCTXRPYTWJB-NZQZLILVSA-N |
| XLogP | -0.63 |
| TPSA | 127.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |