C30H35Cl3N6O3 — CID 159550892
5-chloro-N-[(3,4-dichlorophenyl)methyl]-6-[3-methyl-4-[1-[(4-nitrophenyl)methyl]piperidin-4-yl]piperazin-1-yl]pyridine-3-carboxamide;molecular hydrogen (PubChem CID 159550892) has the molecular formula C30H35Cl3N6O3 and a molecular weight of 634.01 g/mol. Its IUPAC name is 5-chloro-N-[(3,4-dichlorophenyl)methyl]-6-[3-methyl-4-[1-[(4-nitrophenyl)methyl]piperidin-4-yl]piperazin-1-yl]pyridine-3-carboxamide;molecular hydrogen.
| Compound Name | 5-chloro-N-[(3,4-dichlorophenyl)methyl]-6-[3-methyl-4-[1-[(4-nitrophenyl)methyl]piperidin-4-yl]piperazin-1-yl]pyridine-3-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 159550892 |
| Molecular Formula | C30H35Cl3N6O3 |
| Molecular Weight | 634.01 g/mol |
| Exact Mass | 632.18 |
| IUPAC Name | 5-chloro-N-[(3,4-dichlorophenyl)methyl]-6-[3-methyl-4-[1-[(4-nitrophenyl)methyl]piperidin-4-yl]piperazin-1-yl]pyridine-3-carboxamide;molecular hydrogen |
| SMILES | CC1CN(c2ncc(C(=O)NCc3ccc(Cl)c(Cl)c3)cc2Cl)CCN1C1CCN(Cc2ccc([N+](=O)[O-])cc2)CC1.[H][H] |
| InChI | InChI=1S/C30H33Cl3N6O3.H2/c1-20-18-37(29-28(33)15-23(17-34-29)30(40)35-16-22-4-7-26(31)27(32)14-22)12-13-38(20)24-8-10-36(11-9-24)19-21-2-5-25(6-3-21)39(41)42;/h2-7,14-15,17,20,24H,8-13,16,18-19H2,1H3,(H,35,40);1H |
| InChIKey | NOTKPPINEXCMAI-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 94.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.01 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|