C29H32Cl2N6O3 — CID 59427697
5-chloro-N-[(3-chlorophenyl)methyl]-6-[4-[1-[(4-nitrophenyl)methyl]piperidin-4-yl]piperazin-1-yl]pyridine-3-carboxamide (PubChem CID 59427697) has the molecular formula C29H32Cl2N6O3 and a molecular weight of 583.52 g/mol. Its IUPAC name is 5-chloro-N-[(3-chlorophenyl)methyl]-6-[4-[1-[(4-nitrophenyl)methyl]piperidin-4-yl]piperazin-1-yl]pyridine-3-carboxamide.
| Compound Name | 5-chloro-N-[(3-chlorophenyl)methyl]-6-[4-[1-[(4-nitrophenyl)methyl]piperidin-4-yl]piperazin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 59427697 |
| Molecular Formula | C29H32Cl2N6O3 |
| Molecular Weight | 583.52 g/mol |
| Exact Mass | 582.19 |
| IUPAC Name | 5-chloro-N-[(3-chlorophenyl)methyl]-6-[4-[1-[(4-nitrophenyl)methyl]piperidin-4-yl]piperazin-1-yl]pyridine-3-carboxamide |
| SMILES | O=C(NCc1cccc(Cl)c1)c1cnc(N2CCN(C3CCN(Cc4ccc([N+](=O)[O-])cc4)CC3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C29H32Cl2N6O3/c30-24-3-1-2-22(16-24)18-33-29(38)23-17-27(31)28(32-19-23)36-14-12-35(13-15-36)25-8-10-34(11-9-25)20-21-4-6-26(7-5-21)37(39)40/h1-7,16-17,19,25H,8-15,18,20H2,(H,33,38) |
| InChIKey | ANFXVVZKKVTVOI-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 94.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.52 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|