About carbon dioxide;2-methyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylic acid
carbon dioxide;2-methyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylic acid (PubChem CID 159558060) has the molecular formula C10H13NO4
and a molecular weight of 211.22 g/mol. Its IUPAC name is carbon dioxide;2-methyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylic acid.
Molecular Properties
| Compound Name | carbon dioxide;2-methyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylic acid |
| PubChem CID | 159558060 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | carbon dioxide;2-methyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylic acid |
| SMILES | CN1CC2C=CC1C(C(=O)O)C2.O=C=O |
| InChI | InChI=1S/C9H13NO2.CO2/c1-10-5-6-2-3-8(10)7(4-6)9(11)12;2-1-3/h2-3,6-8H,4-5H2,1H3,(H,11,12); |
| InChIKey | MGGAOBDPHJFDTN-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze carbon dioxide;2-methyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;2-methyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylic acid?
The IUPAC name of carbon dioxide;2-methyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylic acid (CID 159558060) is carbon dioxide;2-methyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylic acid.
What is the SMILES notation for carbon dioxide;2-methyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylic acid?
The canonical SMILES for carbon dioxide;2-methyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylic acid is CN1CC2C=CC1C(C(=O)O)C2.O=C=O.
What is the InChIKey of carbon dioxide;2-methyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylic acid?
The InChIKey is MGGAOBDPHJFDTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2.CO2/c1-10-5-6-2-3-8(10)7(4-6)9(11)12;2-1-3/h2-3,6-8H,4-5H2,1H3,(H,11,12);.
What are the key properties of carbon dioxide;2-methyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylic acid?
carbon dioxide;2-methyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylic acid has a molecular weight of 211.22 g/mol, XLogP of -0.01, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;2-methyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylic acid is sourced from PubChem (CID 159558060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).