C10H13NO4 — CID 159558060
carbon dioxide;2-methyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylic acid (PubChem CID 159558060) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is carbon dioxide;2-methyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylic acid.
| Compound Name | carbon dioxide;2-methyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylic acid |
|---|---|
| PubChem CID | 159558060 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | carbon dioxide;2-methyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylic acid |
| SMILES | CN1CC2C=CC1C(C(=O)O)C2.O=C=O |
| InChI | InChI=1S/C9H13NO2.CO2/c1-10-5-6-2-3-8(10)7(4-6)9(11)12;2-1-3/h2-3,6-8H,4-5H2,1H3,(H,11,12); |
| InChIKey | MGGAOBDPHJFDTN-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|