C20H21F2N3O2S — CID 15955994
1-cyclohexyl-3-[[5-(3,5-difluorophenyl)-2-hydroxybenzoyl]amino]thiourea (PubChem CID 15955994) has the molecular formula C20H21F2N3O2S and a molecular weight of 405.47 g/mol. Its IUPAC name is 1-cyclohexyl-3-[[5-(3,5-difluorophenyl)-2-hydroxybenzoyl]amino]thiourea.
| Compound Name | 1-cyclohexyl-3-[[5-(3,5-difluorophenyl)-2-hydroxybenzoyl]amino]thiourea |
|---|---|
| PubChem CID | 15955994 |
| Molecular Formula | C20H21F2N3O2S |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 1-cyclohexyl-3-[[5-(3,5-difluorophenyl)-2-hydroxybenzoyl]amino]thiourea |
| SMILES | O=C(NNC(=S)NC1CCCCC1)c1cc(-c2cc(F)cc(F)c2)ccc1O |
| InChI | InChI=1S/C20H21F2N3O2S/c21-14-8-13(9-15(22)11-14)12-6-7-18(26)17(10-12)19(27)24-25-20(28)23-16-4-2-1-3-5-16/h6-11,16,26H,1-5H2,(H,24,27)(H2,23,25,28) |
| InChIKey | FIKXSWCUCWUCSV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|