C17H21FN2O3 — CID 96562007
N-[(1S,3S)-3-(cyclopropylcarbamoyl)cyclohexyl]-5-fluoro-2-hydroxybenzamide (PubChem CID 96562007) has the molecular formula C17H21FN2O3 and a molecular weight of 320.36 g/mol. Its IUPAC name is N-[(1S,3S)-3-(cyclopropylcarbamoyl)cyclohexyl]-5-fluoro-2-hydroxybenzamide.
| Compound Name | N-[(1S,3S)-3-(cyclopropylcarbamoyl)cyclohexyl]-5-fluoro-2-hydroxybenzamide |
|---|---|
| PubChem CID | 96562007 |
| Molecular Formula | C17H21FN2O3 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | N-[(1S,3S)-3-(cyclopropylcarbamoyl)cyclohexyl]-5-fluoro-2-hydroxybenzamide |
| SMILES | O=C(N[C@H]1CCC[C@H](C(=O)NC2CC2)C1)c1cc(F)ccc1O |
| InChI | InChI=1S/C17H21FN2O3/c18-11-4-7-15(21)14(9-11)17(23)20-13-3-1-2-10(8-13)16(22)19-12-5-6-12/h4,7,9-10,12-13,21H,1-3,5-6,8H2,(H,19,22)(H,20,23)/t10-,13-/m0/s1 |
| InChIKey | KAGSZRWBGGFKSD-GWCFXTLKSA-N |
| XLogP | 2.10 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |