C13H15FINO2 — CID 113225219
4-fluoro-N-(3-hydroxycyclohexyl)-2-iodobenzamide (PubChem CID 113225219) has the molecular formula C13H15FINO2 and a molecular weight of 363.17 g/mol. Its IUPAC name is 4-fluoro-N-(3-hydroxycyclohexyl)-2-iodobenzamide.
| Compound Name | 4-fluoro-N-(3-hydroxycyclohexyl)-2-iodobenzamide |
|---|---|
| PubChem CID | 113225219 |
| Molecular Formula | C13H15FINO2 |
| Molecular Weight | 363.17 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | 4-fluoro-N-(3-hydroxycyclohexyl)-2-iodobenzamide |
| SMILES | O=C(NC1CCCC(O)C1)c1ccc(F)cc1I |
| InChI | InChI=1S/C13H15FINO2/c14-8-4-5-11(12(15)6-8)13(18)16-9-2-1-3-10(17)7-9/h4-6,9-10,17H,1-3,7H2,(H,16,18) |
| InChIKey | SRAKWXODQXSJSW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.17 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|