C16H15ClF3N3O — CID 15956124
N-[4-chloro-3-(3-methylbut-2-enoxy)phenyl]-4-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 15956124) has the molecular formula C16H15ClF3N3O and a molecular weight of 357.76 g/mol. Its IUPAC name is N-[4-chloro-3-(3-methylbut-2-enoxy)phenyl]-4-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-[4-chloro-3-(3-methylbut-2-enoxy)phenyl]-4-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 15956124 |
| Molecular Formula | C16H15ClF3N3O |
| Molecular Weight | 357.76 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | N-[4-chloro-3-(3-methylbut-2-enoxy)phenyl]-4-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | CC(C)=CCOc1cc(Nc2nccc(C(F)(F)F)n2)ccc1Cl |
| InChI | InChI=1S/C16H15ClF3N3O/c1-10(2)6-8-24-13-9-11(3-4-12(13)17)22-15-21-7-5-14(23-15)16(18,19)20/h3-7,9H,8H2,1-2H3,(H,21,22,23) |
| InChIKey | HKWGAORJFOAVDY-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.76 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|