C16H19ClN4O — CID 15956131
2-N-[4-chloro-3-(3-methylbut-2-enoxy)phenyl]-6-methylpyrimidine-2,4-diamine (PubChem CID 15956131) has the molecular formula C16H19ClN4O and a molecular weight of 318.81 g/mol. Its IUPAC name is 2-N-[4-chloro-3-(3-methylbut-2-enoxy)phenyl]-6-methylpyrimidine-2,4-diamine.
| Compound Name | 2-N-[4-chloro-3-(3-methylbut-2-enoxy)phenyl]-6-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 15956131 |
| Molecular Formula | C16H19ClN4O |
| Molecular Weight | 318.81 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 2-N-[4-chloro-3-(3-methylbut-2-enoxy)phenyl]-6-methylpyrimidine-2,4-diamine |
| SMILES | CC(C)=CCOc1cc(Nc2nc(C)cc(N)n2)ccc1Cl |
| InChI | InChI=1S/C16H19ClN4O/c1-10(2)6-7-22-14-9-12(4-5-13(14)17)20-16-19-11(3)8-15(18)21-16/h4-6,8-9H,7H2,1-3H3,(H3,18,19,20,21) |
| InChIKey | LPRLDCQUISINBL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.81 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|