C25H28ClN5 — CID 159561649
2-chloro-6-methyl-4-(4-phenylpiperazin-1-yl)pyridine-3-carbonitrile;N,N-dimethylaniline (PubChem CID 159561649) has the molecular formula C25H28ClN5 and a molecular weight of 433.99 g/mol. Its IUPAC name is 2-chloro-6-methyl-4-(4-phenylpiperazin-1-yl)pyridine-3-carbonitrile;N,N-dimethylaniline.
| Compound Name | 2-chloro-6-methyl-4-(4-phenylpiperazin-1-yl)pyridine-3-carbonitrile;N,N-dimethylaniline |
|---|---|
| PubChem CID | 159561649 |
| Molecular Formula | C25H28ClN5 |
| Molecular Weight | 433.99 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 2-chloro-6-methyl-4-(4-phenylpiperazin-1-yl)pyridine-3-carbonitrile;N,N-dimethylaniline |
| SMILES | CN(C)c1ccccc1.Cc1cc(N2CCN(c3ccccc3)CC2)c(C#N)c(Cl)n1 |
| InChI | InChI=1S/C17H17ClN4.C8H11N/c1-13-11-16(15(12-19)17(18)20-13)22-9-7-21(8-10-22)14-5-3-2-4-6-14;1-9(2)8-6-4-3-5-7-8/h2-6,11H,7-10H2,1H3;3-7H,1-2H3 |
| InChIKey | MGRSVPRLSAJXAD-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 46.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.99 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|