C17H26N4OS — CID 159562065
(3R,4S)-1-[(4-amino-5H-cyclopenta[d]pyrimidin-7-yl)methyl]-4-(3-ethylsulfanylpropyl)pyrrolidin-3-ol (PubChem CID 159562065) has the molecular formula C17H26N4OS and a molecular weight of 334.49 g/mol. Its IUPAC name is (3R,4S)-1-[(4-amino-5H-cyclopenta[d]pyrimidin-7-yl)methyl]-4-(3-ethylsulfanylpropyl)pyrrolidin-3-ol.
| Compound Name | (3R,4S)-1-[(4-amino-5H-cyclopenta[d]pyrimidin-7-yl)methyl]-4-(3-ethylsulfanylpropyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 159562065 |
| Molecular Formula | C17H26N4OS |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | (3R,4S)-1-[(4-amino-5H-cyclopenta[d]pyrimidin-7-yl)methyl]-4-(3-ethylsulfanylpropyl)pyrrolidin-3-ol |
| SMILES | CCSCCC[C@H]1CN(CC2=CCc3c(N)ncnc32)C[C@@H]1O |
| InChI | InChI=1S/C17H26N4OS/c1-2-23-7-3-4-12-8-21(10-15(12)22)9-13-5-6-14-16(13)19-11-20-17(14)18/h5,11-12,15,22H,2-4,6-10H2,1H3,(H2,18,19,20)/t12-,15-/m0/s1 |
| InChIKey | FLNHCGVEAFQKNP-WFASDCNBSA-N |
| XLogP | 1.82 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|