C16H25N5O — CID 123651063
1-[(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methyl]-4-pentylpyrrolidin-3-ol (PubChem CID 123651063) has the molecular formula C16H25N5O and a molecular weight of 303.41 g/mol. Its IUPAC name is 1-[(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methyl]-4-pentylpyrrolidin-3-ol.
| Compound Name | 1-[(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methyl]-4-pentylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 123651063 |
| Molecular Formula | C16H25N5O |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.21 |
| IUPAC Name | 1-[(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methyl]-4-pentylpyrrolidin-3-ol |
| SMILES | CCCCCC1CN(Cc2c[nH]c3c(N)ncnc23)CC1O |
| InChI | InChI=1S/C16H25N5O/c1-2-3-4-5-11-7-21(9-13(11)22)8-12-6-18-15-14(12)19-10-20-16(15)17/h6,10-11,13,18,22H,2-5,7-9H2,1H3,(H2,17,19,20) |
| InChIKey | GKCIAZVEWOJKEV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|