C19H29N5O2S — CID 178134587
N-[7-[[3-hydroxy-4-(methylsulfanylmethyl)pyrrolidin-1-yl]methyl]-5H-pyrrolo[3,2-d]pyrimidin-4-yl]hexanamide (PubChem CID 178134587) has the molecular formula C19H29N5O2S and a molecular weight of 391.54 g/mol. Its IUPAC name is N-[7-[[3-hydroxy-4-(methylsulfanylmethyl)pyrrolidin-1-yl]methyl]-5H-pyrrolo[3,2-d]pyrimidin-4-yl]hexanamide.
| Compound Name | N-[7-[[3-hydroxy-4-(methylsulfanylmethyl)pyrrolidin-1-yl]methyl]-5H-pyrrolo[3,2-d]pyrimidin-4-yl]hexanamide |
|---|---|
| PubChem CID | 178134587 |
| Molecular Formula | C19H29N5O2S |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | N-[7-[[3-hydroxy-4-(methylsulfanylmethyl)pyrrolidin-1-yl]methyl]-5H-pyrrolo[3,2-d]pyrimidin-4-yl]hexanamide |
| SMILES | CCCCCC(=O)Nc1ncnc2c(CN3CC(O)C(CSC)C3)c[nH]c12 |
| InChI | InChI=1S/C19H29N5O2S/c1-3-4-5-6-16(26)23-19-18-17(21-12-22-19)13(7-20-18)8-24-9-14(11-27-2)15(25)10-24/h7,12,14-15,20,25H,3-6,8-11H2,1-2H3,(H,21,22,23,26) |
| InChIKey | RQKZVEYZSKZYIN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|