C32H24F2N2O5 — CID 159563432
6-fluoro-5-(4-methoxyphenyl)-1H-indole-3-carbaldehyde;6-fluoro-5-(4-methoxyphenyl)-1H-indole-3-carboxylic acid (PubChem CID 159563432) has the molecular formula C32H24F2N2O5 and a molecular weight of 554.55 g/mol. Its IUPAC name is 6-fluoro-5-(4-methoxyphenyl)-1H-indole-3-carbaldehyde;6-fluoro-5-(4-methoxyphenyl)-1H-indole-3-carboxylic acid.
| Compound Name | 6-fluoro-5-(4-methoxyphenyl)-1H-indole-3-carbaldehyde;6-fluoro-5-(4-methoxyphenyl)-1H-indole-3-carboxylic acid |
|---|---|
| PubChem CID | 159563432 |
| Molecular Formula | C32H24F2N2O5 |
| Molecular Weight | 554.55 g/mol |
| Exact Mass | 554.17 |
| IUPAC Name | 6-fluoro-5-(4-methoxyphenyl)-1H-indole-3-carbaldehyde;6-fluoro-5-(4-methoxyphenyl)-1H-indole-3-carboxylic acid |
| SMILES | COc1ccc(-c2cc3c(C(=O)O)c[nH]c3cc2F)cc1.COc1ccc(-c2cc3c(C=O)c[nH]c3cc2F)cc1 |
| InChI | InChI=1S/C16H12FNO3.C16H12FNO2/c1-21-10-4-2-9(3-5-10)11-6-12-13(16(19)20)8-18-15(12)7-14(11)17;1-20-12-4-2-10(3-5-12)13-6-14-11(9-19)8-18-16(14)7-15(13)17/h2-8,18H,1H3,(H,19,20);2-9,18H,1H3 |
| InChIKey | MGXHXNIBZTZYSG-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 104.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.55 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|