C19H15ClN2O2 — CID 15956399
(2'S,3S)-5-chloro-2'-[6-(3-oxobut-1-enyl)-2-pyridinyl]spiro[1H-indole-3,1'-cyclopropane]-2-one (PubChem CID 15956399) has the molecular formula C19H15ClN2O2 and a molecular weight of 338.79 g/mol. Its IUPAC name is (2'S,3S)-5-chloro-2'-[6-(3-oxobut-1-enyl)-2-pyridinyl]spiro[1H-indole-3,1'-cyclopropane]-2-one.
| Compound Name | (2'S,3S)-5-chloro-2'-[6-(3-oxobut-1-enyl)-2-pyridinyl]spiro[1H-indole-3,1'-cyclopropane]-2-one |
|---|---|
| PubChem CID | 15956399 |
| Molecular Formula | C19H15ClN2O2 |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | (2'S,3S)-5-chloro-2'-[6-(3-oxobut-1-enyl)-2-pyridinyl]spiro[1H-indole-3,1'-cyclopropane]-2-one |
| SMILES | CC(=O)C=Cc1cccc([C@H]2C[C@]23C(=O)Nc2ccc(Cl)cc23)n1 |
| InChI | InChI=1S/C19H15ClN2O2/c1-11(23)5-7-13-3-2-4-16(21-13)15-10-19(15)14-9-12(20)6-8-17(14)22-18(19)24/h2-9,15H,10H2,1H3,(H,22,24)/t15-,19-/m1/s1 |
| InChIKey | MCKATTUSXDYQCI-DNVCBOLYSA-N |
| XLogP | 3.71 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|