C16H23N3O3 — CID 159565900
(4S)-4-methyl-1-[4-(4-methylpiperazine-1-carbonyl)-1,3-oxazol-2-yl]hex-5-en-2-one (PubChem CID 159565900) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is (4S)-4-methyl-1-[4-(4-methylpiperazine-1-carbonyl)-1,3-oxazol-2-yl]hex-5-en-2-one.
| Compound Name | (4S)-4-methyl-1-[4-(4-methylpiperazine-1-carbonyl)-1,3-oxazol-2-yl]hex-5-en-2-one |
|---|---|
| PubChem CID | 159565900 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | (4S)-4-methyl-1-[4-(4-methylpiperazine-1-carbonyl)-1,3-oxazol-2-yl]hex-5-en-2-one |
| SMILES | C=C[C@@H](C)CC(=O)Cc1nc(C(=O)N2CCN(C)CC2)co1 |
| InChI | InChI=1S/C16H23N3O3/c1-4-12(2)9-13(20)10-15-17-14(11-22-15)16(21)19-7-5-18(3)6-8-19/h4,11-12H,1,5-10H2,2-3H3/t12-/m1/s1 |
| InChIKey | MHEPBMZNZKSQPC-GFCCVEGCSA-N |
| XLogP | 1.39 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|