C10H14N4O3 — CID 110850382
1-[4-(2-amino-1,3-oxazole-4-carbonyl)piperazin-1-yl]ethanone (PubChem CID 110850382) has the molecular formula C10H14N4O3 and a molecular weight of 238.25 g/mol. Its IUPAC name is 1-[4-(2-amino-1,3-oxazole-4-carbonyl)piperazin-1-yl]ethanone.
| Compound Name | 1-[4-(2-amino-1,3-oxazole-4-carbonyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 110850382 |
| Molecular Formula | C10H14N4O3 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 1-[4-(2-amino-1,3-oxazole-4-carbonyl)piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(C(=O)c2coc(N)n2)CC1 |
| InChI | InChI=1S/C10H14N4O3/c1-7(15)13-2-4-14(5-3-13)9(16)8-6-17-10(11)12-8/h6H,2-5H2,1H3,(H2,11,12) |
| InChIKey | WAJJVFSSSSCKST-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |