C20H32N2O7S — CID 159568428
3,6-diamino-5-hydroxy-2,2,8-trimethyl-4-oxo-6-phenylmethoxycarbonylnonane-5-sulfonic acid (PubChem CID 159568428) has the molecular formula C20H32N2O7S and a molecular weight of 444.55 g/mol. Its IUPAC name is 3,6-diamino-5-hydroxy-2,2,8-trimethyl-4-oxo-6-phenylmethoxycarbonylnonane-5-sulfonic acid.
| Compound Name | 3,6-diamino-5-hydroxy-2,2,8-trimethyl-4-oxo-6-phenylmethoxycarbonylnonane-5-sulfonic acid |
|---|---|
| PubChem CID | 159568428 |
| Molecular Formula | C20H32N2O7S |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 3,6-diamino-5-hydroxy-2,2,8-trimethyl-4-oxo-6-phenylmethoxycarbonylnonane-5-sulfonic acid |
| SMILES | CC(C)CC(N)(C(=O)OCc1ccccc1)C(O)(C(=O)C(N)C(C)(C)C)S(=O)(=O)O |
| InChI | InChI=1S/C20H32N2O7S/c1-13(2)11-19(22,17(24)29-12-14-9-7-6-8-10-14)20(25,30(26,27)28)16(23)15(21)18(3,4)5/h6-10,13,15,25H,11-12,21-22H2,1-5H3,(H,26,27,28) |
| InChIKey | YXQDTPLMZYJCNF-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 170.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|