C20H31N2NaO7S — CID 158829643
sodium (7S)-4,7-diamino-5-hydroxy-2,9-dimethyl-6-oxo-4-phenylmethoxycarbonyldecane-5-sulfonate (PubChem CID 158829643) has the molecular formula C20H31N2NaO7S and a molecular weight of 466.53 g/mol. Its IUPAC name is sodium (7S)-4,7-diamino-5-hydroxy-2,9-dimethyl-6-oxo-4-phenylmethoxycarbonyldecane-5-sulfonate.
| Compound Name | sodium (7S)-4,7-diamino-5-hydroxy-2,9-dimethyl-6-oxo-4-phenylmethoxycarbonyldecane-5-sulfonate |
|---|---|
| PubChem CID | 158829643 |
| Molecular Formula | C20H31N2NaO7S |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | sodium (7S)-4,7-diamino-5-hydroxy-2,9-dimethyl-6-oxo-4-phenylmethoxycarbonyldecane-5-sulfonate |
| SMILES | CC(C)C[C@H](N)C(=O)C(O)(C(N)(CC(C)C)C(=O)OCc1ccccc1)S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C20H32N2O7S.Na/c1-13(2)10-16(21)17(23)20(25,30(26,27)28)19(22,11-14(3)4)18(24)29-12-15-8-6-5-7-9-15;/h5-9,13-14,16,25H,10-12,21-22H2,1-4H3,(H,26,27,28);/q;+1/p-1/t16-,19?,20?;/m0./s1 |
| InChIKey | IWWPNRLMIHVKPT-RTWVUSEWSA-M |
| XLogP | -2.35 |
| TPSA | 172.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|