C23H35N3O6 — CID 70145382
2-[(2-amino-4-methylpentanoyl)-(2-aminopropanoyl)amino]-4-methyl-2-phenylmethoxycarbonylpentanoic acid (PubChem CID 70145382) has the molecular formula C23H35N3O6 and a molecular weight of 449.55 g/mol. Its IUPAC name is 2-[(2-amino-4-methylpentanoyl)-(2-aminopropanoyl)amino]-4-methyl-2-phenylmethoxycarbonylpentanoic acid.
| Compound Name | 2-[(2-amino-4-methylpentanoyl)-(2-aminopropanoyl)amino]-4-methyl-2-phenylmethoxycarbonylpentanoic acid |
|---|---|
| PubChem CID | 70145382 |
| Molecular Formula | C23H35N3O6 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | 2-[(2-amino-4-methylpentanoyl)-(2-aminopropanoyl)amino]-4-methyl-2-phenylmethoxycarbonylpentanoic acid |
| SMILES | CC(C)CC(N)C(=O)N(C(=O)C(C)N)C(CC(C)C)(C(=O)O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H35N3O6/c1-14(2)11-18(25)20(28)26(19(27)16(5)24)23(21(29)30,12-15(3)4)22(31)32-13-17-9-7-6-8-10-17/h6-10,14-16,18H,11-13,24-25H2,1-5H3,(H,29,30) |
| InChIKey | OQVBYXGXCZYNBH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 153.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|