C22H27N2NaO7S — CID 87965924
sodium 3-[[(2S)-2-amino-3-methylbutanoyl]amino]-2-hydroxy-1-oxo-4-phenyl-1-phenylmethoxybutane-2-sulfonate (PubChem CID 87965924) has the molecular formula C22H27N2NaO7S and a molecular weight of 486.52 g/mol. Its IUPAC name is sodium 3-[[(2S)-2-amino-3-methylbutanoyl]amino]-2-hydroxy-1-oxo-4-phenyl-1-phenylmethoxybutane-2-sulfonate.
| Compound Name | sodium 3-[[(2S)-2-amino-3-methylbutanoyl]amino]-2-hydroxy-1-oxo-4-phenyl-1-phenylmethoxybutane-2-sulfonate |
|---|---|
| PubChem CID | 87965924 |
| Molecular Formula | C22H27N2NaO7S |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | sodium 3-[[(2S)-2-amino-3-methylbutanoyl]amino]-2-hydroxy-1-oxo-4-phenyl-1-phenylmethoxybutane-2-sulfonate |
| SMILES | CC(C)[C@H](N)C(=O)NC(Cc1ccccc1)C(O)(C(=O)OCc1ccccc1)S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C22H28N2O7S.Na/c1-15(2)19(23)20(25)24-18(13-16-9-5-3-6-10-16)22(27,32(28,29)30)21(26)31-14-17-11-7-4-8-12-17;/h3-12,15,18-19,27H,13-14,23H2,1-2H3,(H,24,25)(H,28,29,30);/q;+1/p-1/t18?,19-,22?;/m0./s1 |
| InChIKey | BTVHKBINPPRSKK-FBFXXDSESA-M |
| XLogP | -2.32 |
| TPSA | 158.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|