C21H16N4O4 — CID 15956854
ethyl 3-naphthalen-2-yl-1-(3-nitro-2-pyridinyl)pyrazole-5-carboxylate (PubChem CID 15956854) has the molecular formula C21H16N4O4 and a molecular weight of 388.38 g/mol. Its IUPAC name is ethyl 3-naphthalen-2-yl-1-(3-nitro-2-pyridinyl)pyrazole-5-carboxylate.
| Compound Name | ethyl 3-naphthalen-2-yl-1-(3-nitro-2-pyridinyl)pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 15956854 |
| Molecular Formula | C21H16N4O4 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | ethyl 3-naphthalen-2-yl-1-(3-nitro-2-pyridinyl)pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc3ccccc3c2)nn1-c1ncccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H16N4O4/c1-2-29-21(26)19-13-17(16-10-9-14-6-3-4-7-15(14)12-16)23-24(19)20-18(25(27)28)8-5-11-22-20/h3-13H,2H2,1H3 |
| InChIKey | MQHOLHCBVPEPSF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 100.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|