C16H23BrO2 — CID 159571434
tert-butyl 3-(4-bromo-2,3-dimethylphenyl)butanoate (PubChem CID 159571434) has the molecular formula C16H23BrO2 and a molecular weight of 327.26 g/mol. Its IUPAC name is tert-butyl 3-(4-bromo-2,3-dimethylphenyl)butanoate.
| Compound Name | tert-butyl 3-(4-bromo-2,3-dimethylphenyl)butanoate |
|---|---|
| PubChem CID | 159571434 |
| Molecular Formula | C16H23BrO2 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | tert-butyl 3-(4-bromo-2,3-dimethylphenyl)butanoate |
| SMILES | Cc1c(Br)ccc(C(C)CC(=O)OC(C)(C)C)c1C |
| InChI | InChI=1S/C16H23BrO2/c1-10(9-15(18)19-16(4,5)6)13-7-8-14(17)12(3)11(13)2/h7-8,10H,9H2,1-6H3 |
| InChIKey | MHWGWPJGERARBK-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |