About 4-methylbenzoyl isocyanide
4-methylbenzoyl isocyanide (PubChem CID 159571574) has the molecular formula C9H7NO
and a molecular weight of 145.16 g/mol. Its IUPAC name is 4-methylbenzoyl isocyanide.
Molecular Properties
| Compound Name | 4-methylbenzoyl isocyanide |
| PubChem CID | 159571574 |
| Molecular Formula | C9H7NO |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.05 |
| IUPAC Name | 4-methylbenzoyl isocyanide |
| SMILES | [C-]#[N+]C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C9H7NO/c1-7-3-5-8(6-4-7)9(11)10-2/h3-6H,1H3 |
| InChIKey | HVXCZUXAADMSOX-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 21.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-methylbenzoyl isocyanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzoyl isocyanide?
The IUPAC name of 4-methylbenzoyl isocyanide (CID 159571574) is 4-methylbenzoyl isocyanide.
What is the SMILES notation for 4-methylbenzoyl isocyanide?
The canonical SMILES for 4-methylbenzoyl isocyanide is [C-]#[N+]C(=O)c1ccc(C)cc1.
What is the InChIKey of 4-methylbenzoyl isocyanide?
The InChIKey is HVXCZUXAADMSOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO/c1-7-3-5-8(6-4-7)9(11)10-2/h3-6H,1H3.
What are the key properties of 4-methylbenzoyl isocyanide?
4-methylbenzoyl isocyanide has a molecular weight of 145.16 g/mol, XLogP of 2.05, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzoyl isocyanide is sourced from PubChem (CID 159571574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).