C39H48F3N5O4 — CID 159572234
3-[4-[4-[2-[1-[[2-(trifluoromethoxy)-4-(1,4,5-trimethyl-6-oxo-3-pyridinyl)phenyl]methyl]piperidin-4-yl]ethyl]piperidin-1-yl]anilino]piperidine-2,6-dione (PubChem CID 159572234) has the molecular formula C39H48F3N5O4 and a molecular weight of 707.84 g/mol. Its IUPAC name is 3-[4-[4-[2-[1-[[2-(trifluoromethoxy)-4-(1,4,5-trimethyl-6-oxo-3-pyridinyl)phenyl]methyl]piperidin-4-yl]ethyl]piperidin-1-yl]anilino]piperidine-2,6-dione.
| Compound Name | 3-[4-[4-[2-[1-[[2-(trifluoromethoxy)-4-(1,4,5-trimethyl-6-oxo-3-pyridinyl)phenyl]methyl]piperidin-4-yl]ethyl]piperidin-1-yl]anilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 159572234 |
| Molecular Formula | C39H48F3N5O4 |
| Molecular Weight | 707.84 g/mol |
| Exact Mass | 707.37 |
| IUPAC Name | 3-[4-[4-[2-[1-[[2-(trifluoromethoxy)-4-(1,4,5-trimethyl-6-oxo-3-pyridinyl)phenyl]methyl]piperidin-4-yl]ethyl]piperidin-1-yl]anilino]piperidine-2,6-dione |
| SMILES | Cc1c(-c2ccc(CN3CCC(CCC4CCN(c5ccc(NC6CCC(=O)NC6=O)cc5)CC4)CC3)c(OC(F)(F)F)c2)cn(C)c(=O)c1C |
| InChI | InChI=1S/C39H48F3N5O4/c1-25-26(2)38(50)45(3)24-33(25)29-6-7-30(35(22-29)51-39(40,41)42)23-46-18-14-27(15-19-46)4-5-28-16-20-47(21-17-28)32-10-8-31(9-11-32)43-34-12-13-36(48)44-37(34)49/h6-11,22,24,27-28,34,43H,4-5,12-21,23H2,1-3H3,(H,44,48,49) |
| InChIKey | MHYSYGFDLXPXJJ-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.84 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|