C36H42ClF3N6O4 — CID 164719862
3-[4-[4-[1-[[2-chloro-6-methoxy-4-(1,4,5-trimethyl-6-oxo-3-pyridinyl)phenyl]methyl]-3,3-difluoropiperidin-4-yl]piperazin-1-yl]-3-fluoroanilino]piperidine-2,6-dione (PubChem CID 164719862) has the molecular formula C36H42ClF3N6O4 and a molecular weight of 715.22 g/mol. Its IUPAC name is 3-[4-[4-[1-[[2-chloro-6-methoxy-4-(1,4,5-trimethyl-6-oxo-3-pyridinyl)phenyl]methyl]-3,3-difluoropiperidin-4-yl]piperazin-1-yl]-3-fluoroanilino]piperidine-2,6-dione.
| Compound Name | 3-[4-[4-[1-[[2-chloro-6-methoxy-4-(1,4,5-trimethyl-6-oxo-3-pyridinyl)phenyl]methyl]-3,3-difluoropiperidin-4-yl]piperazin-1-yl]-3-fluoroanilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 164719862 |
| Molecular Formula | C36H42ClF3N6O4 |
| Molecular Weight | 715.22 g/mol |
| Exact Mass | 714.29 |
| IUPAC Name | 3-[4-[4-[1-[[2-chloro-6-methoxy-4-(1,4,5-trimethyl-6-oxo-3-pyridinyl)phenyl]methyl]-3,3-difluoropiperidin-4-yl]piperazin-1-yl]-3-fluoroanilino]piperidine-2,6-dione |
| SMILES | COc1cc(-c2cn(C)c(=O)c(C)c2C)cc(Cl)c1CN1CCC(N2CCN(c3ccc(NC4CCC(=O)NC4=O)cc3F)CC2)C(F)(F)C1 |
| InChI | InChI=1S/C36H42ClF3N6O4/c1-21-22(2)35(49)43(3)18-25(21)23-15-27(37)26(31(16-23)50-4)19-44-10-9-32(36(39,40)20-44)46-13-11-45(12-14-46)30-7-5-24(17-28(30)38)41-29-6-8-33(47)42-34(29)48/h5,7,15-18,29,32,41H,6,8-14,19-20H2,1-4H3,(H,42,47,48) |
| InChIKey | ULJKOQDVPWTSPY-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.22 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|