C39H50FN5O4 — CID 160533413
3-[4-[4-[2-[1-[[2-fluoro-6-methoxy-4-(1,4,5-trimethyl-6-oxo-3-pyridinyl)phenyl]methyl]piperidin-4-yl]ethyl]piperidin-1-yl]anilino]piperidine-2,6-dione (PubChem CID 160533413) has the molecular formula C39H50FN5O4 and a molecular weight of 671.86 g/mol. Its IUPAC name is 3-[4-[4-[2-[1-[[2-fluoro-6-methoxy-4-(1,4,5-trimethyl-6-oxo-3-pyridinyl)phenyl]methyl]piperidin-4-yl]ethyl]piperidin-1-yl]anilino]piperidine-2,6-dione.
| Compound Name | 3-[4-[4-[2-[1-[[2-fluoro-6-methoxy-4-(1,4,5-trimethyl-6-oxo-3-pyridinyl)phenyl]methyl]piperidin-4-yl]ethyl]piperidin-1-yl]anilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 160533413 |
| Molecular Formula | C39H50FN5O4 |
| Molecular Weight | 671.86 g/mol |
| Exact Mass | 671.38 |
| IUPAC Name | 3-[4-[4-[2-[1-[[2-fluoro-6-methoxy-4-(1,4,5-trimethyl-6-oxo-3-pyridinyl)phenyl]methyl]piperidin-4-yl]ethyl]piperidin-1-yl]anilino]piperidine-2,6-dione |
| SMILES | COc1cc(-c2cn(C)c(=O)c(C)c2C)cc(F)c1CN1CCC(CCC2CCN(c3ccc(NC4CCC(=O)NC4=O)cc3)CC2)CC1 |
| InChI | InChI=1S/C39H50FN5O4/c1-25-26(2)39(48)43(3)23-32(25)29-21-34(40)33(36(22-29)49-4)24-44-17-13-27(14-18-44)5-6-28-15-19-45(20-16-28)31-9-7-30(8-10-31)41-35-11-12-37(46)42-38(35)47/h7-10,21-23,27-28,35,41H,5-6,11-20,24H2,1-4H3,(H,42,46,47) |
| InChIKey | QVVPSBNVGKDQQO-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.86 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|