C31H37N5O2 — CID 159575369
N-[2-(4,4-dimethylcyclohexen-1-yl)-4-[1-(2-imidazol-1-ylethoxy)cyclohexyl]phenyl]-5-isocyano-3H-pyrrole-2-carboxamide (PubChem CID 159575369) has the molecular formula C31H37N5O2 and a molecular weight of 511.67 g/mol. Its IUPAC name is N-[2-(4,4-dimethylcyclohexen-1-yl)-4-[1-(2-imidazol-1-ylethoxy)cyclohexyl]phenyl]-5-isocyano-3H-pyrrole-2-carboxamide.
| Compound Name | N-[2-(4,4-dimethylcyclohexen-1-yl)-4-[1-(2-imidazol-1-ylethoxy)cyclohexyl]phenyl]-5-isocyano-3H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 159575369 |
| Molecular Formula | C31H37N5O2 |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.29 |
| IUPAC Name | N-[2-(4,4-dimethylcyclohexen-1-yl)-4-[1-(2-imidazol-1-ylethoxy)cyclohexyl]phenyl]-5-isocyano-3H-pyrrole-2-carboxamide |
| SMILES | [C-]#[N+]C1=CCC(C(=O)Nc2ccc(C3(OCCn4ccnc4)CCCCC3)cc2C2=CCC(C)(C)CC2)=N1 |
| InChI | InChI=1S/C31H37N5O2/c1-30(2)15-11-23(12-16-30)25-21-24(7-8-26(25)35-29(37)27-9-10-28(32-3)34-27)31(13-5-4-6-14-31)38-20-19-36-18-17-33-22-36/h7-8,10-11,17-18,21-22H,4-6,9,12-16,19-20H2,1-2H3,(H,35,37) |
| InChIKey | MIIKVNJKIBEIRA-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 72.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|