C34H40FN11O2 — CID 159577404
(2R)-2-[[6-(benzylamino)-9-propan-2-ylpurin-2-yl]amino]butanoic acid;N-benzyl-2-fluoro-9-propan-2-ylpurin-6-amine (PubChem CID 159577404) has the molecular formula C34H40FN11O2 and a molecular weight of 653.77 g/mol. Its IUPAC name is (2R)-2-[[6-(benzylamino)-9-propan-2-ylpurin-2-yl]amino]butanoic acid;N-benzyl-2-fluoro-9-propan-2-ylpurin-6-amine.
| Compound Name | (2R)-2-[[6-(benzylamino)-9-propan-2-ylpurin-2-yl]amino]butanoic acid;N-benzyl-2-fluoro-9-propan-2-ylpurin-6-amine |
|---|---|
| PubChem CID | 159577404 |
| Molecular Formula | C34H40FN11O2 |
| Molecular Weight | 653.77 g/mol |
| Exact Mass | 653.34 |
| IUPAC Name | (2R)-2-[[6-(benzylamino)-9-propan-2-ylpurin-2-yl]amino]butanoic acid;N-benzyl-2-fluoro-9-propan-2-ylpurin-6-amine |
| SMILES | CC(C)n1cnc2c(NCc3ccccc3)nc(F)nc21.CC[C@@H](Nc1nc(NCc2ccccc2)c2ncn(C(C)C)c2n1)C(=O)O |
| InChI | InChI=1S/C19H24N6O2.C15H16FN5/c1-4-14(18(26)27)22-19-23-16(20-10-13-8-6-5-7-9-13)15-17(24-19)25(11-21-15)12(2)3;1-10(2)21-9-18-12-13(19-15(16)20-14(12)21)17-8-11-6-4-3-5-7-11/h5-9,11-12,14H,4,10H2,1-3H3,(H,26,27)(H2,20,22,23,24);3-7,9-10H,8H2,1-2H3,(H,17,19,20)/t14-;/m1./s1 |
| InChIKey | MIOSKARXPJYWCI-PFEQFJNWSA-N |
| XLogP | 6.45 |
| TPSA | 160.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.77 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |