C21H21F7N2O4 — CID 159579274
ethyl 4,4,4-trifluoro-2-formylbutanoate;2-[2-(4-fluorophenyl)ethyl]-5-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one (PubChem CID 159579274) has the molecular formula C21H21F7N2O4 and a molecular weight of 498.40 g/mol. Its IUPAC name is ethyl 4,4,4-trifluoro-2-formylbutanoate;2-[2-(4-fluorophenyl)ethyl]-5-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one.
| Compound Name | ethyl 4,4,4-trifluoro-2-formylbutanoate;2-[2-(4-fluorophenyl)ethyl]-5-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 159579274 |
| Molecular Formula | C21H21F7N2O4 |
| Molecular Weight | 498.40 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | ethyl 4,4,4-trifluoro-2-formylbutanoate;2-[2-(4-fluorophenyl)ethyl]-5-(2,2,2-trifluoroethyl)-1H-pyrimidin-6-one |
| SMILES | CCOC(=O)C(C=O)CC(F)(F)F.O=c1[nH]c(CCc2ccc(F)cc2)ncc1CC(F)(F)F |
| InChI | InChI=1S/C14H12F4N2O.C7H9F3O3/c15-11-4-1-9(2-5-11)3-6-12-19-8-10(13(21)20-12)7-14(16,17)18;1-2-13-6(12)5(4-11)3-7(8,9)10/h1-2,4-5,8H,3,6-7H2,(H,19,20,21);4-5H,2-3H2,1H3 |
| InChIKey | MIUPHBVATHUZIW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|