C17H21FN2O — CID 142695972
2-[2-(4-fluorophenyl)ethyl]-4-methyl-5-(2-methylpropyl)-1H-pyrimidin-6-one (PubChem CID 142695972) has the molecular formula C17H21FN2O and a molecular weight of 288.37 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)ethyl]-4-methyl-5-(2-methylpropyl)-1H-pyrimidin-6-one.
| Compound Name | 2-[2-(4-fluorophenyl)ethyl]-4-methyl-5-(2-methylpropyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 142695972 |
| Molecular Formula | C17H21FN2O |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 2-[2-(4-fluorophenyl)ethyl]-4-methyl-5-(2-methylpropyl)-1H-pyrimidin-6-one |
| SMILES | Cc1nc(CCc2ccc(F)cc2)[nH]c(=O)c1CC(C)C |
| InChI | InChI=1S/C17H21FN2O/c1-11(2)10-15-12(3)19-16(20-17(15)21)9-6-13-4-7-14(18)8-5-13/h4-5,7-8,11H,6,9-10H2,1-3H3,(H,19,20,21) |
| InChIKey | MTSFOYALLNYAPJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |