C36H38Br2N4O2 — CID 159581680
1,2-bis(bromomethyl)-4-methoxybenzene;5-(5-methoxy-1,3-dihydroisoindol-2-yl)-1-methylindole;1-methylindol-5-amine (PubChem CID 159581680) has the molecular formula C36H38Br2N4O2 and a molecular weight of 718.53 g/mol. Its IUPAC name is 1,2-bis(bromomethyl)-4-methoxybenzene;5-(5-methoxy-1,3-dihydroisoindol-2-yl)-1-methylindole;1-methylindol-5-amine.
| Compound Name | 1,2-bis(bromomethyl)-4-methoxybenzene;5-(5-methoxy-1,3-dihydroisoindol-2-yl)-1-methylindole;1-methylindol-5-amine |
|---|---|
| PubChem CID | 159581680 |
| Molecular Formula | C36H38Br2N4O2 |
| Molecular Weight | 718.53 g/mol |
| Exact Mass | 716.14 |
| IUPAC Name | 1,2-bis(bromomethyl)-4-methoxybenzene;5-(5-methoxy-1,3-dihydroisoindol-2-yl)-1-methylindole;1-methylindol-5-amine |
| SMILES | COc1ccc(CBr)c(CBr)c1.COc1ccc2c(c1)CN(c1ccc3c(ccn3C)c1)C2.Cn1ccc2cc(N)ccc21 |
| InChI | InChI=1S/C18H18N2O.C9H10Br2O.C9H10N2/c1-19-8-7-13-9-16(4-6-18(13)19)20-11-14-3-5-17(21-2)10-15(14)12-20;1-12-9-3-2-7(5-10)8(4-9)6-11;1-11-5-4-7-6-8(10)2-3-9(7)11/h3-10H,11-12H2,1-2H3;2-4H,5-6H2,1H3;2-6H,10H2,1H3 |
| InChIKey | MJCCFVLTWNBVIU-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.53 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk_indol_A(1)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|